C18H18N6O — CID 118562760
(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-4-ylprop-2-enehydrazide (PubChem CID 118562760) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is (Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-4-ylprop-2-enehydrazide.
| Compound Name | (Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-4-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 118562760 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-4-ylprop-2-enehydrazide |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C\C(=O)NNc3ccncc3)n2)c1 |
| InChI | InChI=1S/C18H18N6O/c1-13-9-14(2)11-15(10-13)18-20-12-24(23-18)8-5-17(25)22-21-16-3-6-19-7-4-16/h3-12H,1-2H3,(H,19,21)(H,22,25)/b8-5- |
| InChIKey | ZYTNTLKYEWPMSW-YVMONPNESA-N |
| XLogP | 2.57 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|