C20H19F3N6O — CID 90349263
(Z)-N'-methyl-N'-(3-methyl-2-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide (PubChem CID 90349263) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is (Z)-N'-methyl-N'-(3-methyl-2-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide.
| Compound Name | (Z)-N'-methyl-N'-(3-methyl-2-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 90349263 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (Z)-N'-methyl-N'-(3-methyl-2-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide |
| SMILES | Cc1cc(-c2ncn(/C=C\C(=O)NN(C)c3ncccc3C)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N6O/c1-13-9-15(11-16(10-13)20(21,22)23)18-25-12-29(27-18)8-6-17(30)26-28(3)19-14(2)5-4-7-24-19/h4-12H,1-3H3,(H,26,30)/b8-6- |
| InChIKey | YQENNVZFLJSDPV-VURMDHGXSA-N |
| XLogP | 3.61 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|