C18H14F6N6O — CID 170121495
(Z)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,5-dihydro-1,2,4-triazol-2-yl]-N'-pyridin-2-ylprop-2-enehydrazide (PubChem CID 170121495) has the molecular formula C18H14F6N6O and a molecular weight of 444.34 g/mol. Its IUPAC name is (Z)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,5-dihydro-1,2,4-triazol-2-yl]-N'-pyridin-2-ylprop-2-enehydrazide.
| Compound Name | (Z)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,5-dihydro-1,2,4-triazol-2-yl]-N'-pyridin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 170121495 |
| Molecular Formula | C18H14F6N6O |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (Z)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,5-dihydro-1,2,4-triazol-2-yl]-N'-pyridin-2-ylprop-2-enehydrazide |
| SMILES | O=C(/C=C\N1C=NC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N1)NNc1ccccn1 |
| InChI | InChI=1S/C18H14F6N6O/c19-17(20,21)12-7-11(8-13(9-12)18(22,23)24)16-26-10-30(29-16)6-4-15(31)28-27-14-3-1-2-5-25-14/h1-10,16,29H,(H,25,27)(H,28,31)/b6-4- |
| InChIKey | DVFOLRMBZSNTOK-XQRVVYSFSA-N |
| XLogP | 3.62 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|