C19H16F4N6O — CID 118674419
2-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-N'-pyridin-2-ylprop-2-enehydrazide (PubChem CID 118674419) has the molecular formula C19H16F4N6O and a molecular weight of 420.37 g/mol. Its IUPAC name is 2-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-N'-pyridin-2-ylprop-2-enehydrazide.
| Compound Name | 2-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-N'-pyridin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 118674419 |
| Molecular Formula | C19H16F4N6O |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[[3-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-N'-pyridin-2-ylprop-2-enehydrazide |
| SMILES | C=C(Cn1cnc(-c2cc(CF)cc(C(F)(F)F)c2)n1)C(=O)NNc1ccccn1 |
| InChI | InChI=1S/C19H16F4N6O/c1-12(18(30)27-26-16-4-2-3-5-24-16)10-29-11-25-17(28-29)14-6-13(9-20)7-15(8-14)19(21,22)23/h2-8,11H,1,9-10H2,(H,24,26)(H,27,30) |
| InChIKey | QSCPYZMNVFIHNX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|