C19H18F3N7O — CID 8681669
1-(4-pyridin-2-ylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone (PubChem CID 8681669) has the molecular formula C19H18F3N7O and a molecular weight of 417.40 g/mol. Its IUPAC name is 1-(4-pyridin-2-ylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone.
| Compound Name | 1-(4-pyridin-2-ylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 8681669 |
| Molecular Formula | C19H18F3N7O |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-(4-pyridin-2-ylpiperazin-1-yl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone |
| SMILES | O=C(Cn1nnc(-c2cccc(C(F)(F)F)c2)n1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H18F3N7O/c20-19(21,22)15-5-3-4-14(12-15)18-24-26-29(25-18)13-17(30)28-10-8-27(9-11-28)16-6-1-2-7-23-16/h1-7,12H,8-11,13H2 |
| InChIKey | BTIPZVOKTBGLLC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |