C21H20F3N5 — CID 4288228
2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 4288228) has the molecular formula C21H20F3N5 and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 4288228 |
| Molecular Formula | C21H20F3N5 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)cc(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C21H20F3N5/c1-15-26-18(16-5-4-6-17(13-16)21(22,23)24)14-20(27-15)29-11-9-28(10-12-29)19-7-2-3-8-25-19/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | IBMMXQIHSHRJNJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |