C16H18F3N5 — CID 11267697
4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 11267697) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 11267697 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2cc(-c3cccc(C(F)(F)F)c3)nc(N)n2)CC1 |
| InChI | InChI=1S/C16H18F3N5/c1-23-5-7-24(8-6-23)14-10-13(21-15(20)22-14)11-3-2-4-12(9-11)16(17,18)19/h2-4,9-10H,5-8H2,1H3,(H2,20,21,22) |
| InChIKey | JPMNTGUMTSNTFH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |