C16H14F9N5O2S — CID 169079326
2-fluoro-2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide (PubChem CID 169079326) has the molecular formula C16H14F9N5O2S and a molecular weight of 511.37 g/mol. Its IUPAC name is 2-fluoro-2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide.
| Compound Name | 2-fluoro-2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 169079326 |
| Molecular Formula | C16H14F9N5O2S |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 2-fluoro-2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
| SMILES | CC(C)(F)C(=O)N(N)C(=O)C=Cn1cnc(-c2cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H14F9N5O2S/c1-15(2,17)14(32)30(26)12(31)3-4-29-8-27-13(28-29)9-5-10(16(18,19)20)7-11(6-9)33(21,22,23,24)25/h3-8H,26H2,1-2H3 |
| InChIKey | XJMAKZWTGOACAI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|