C15H12F8IN3O2S — CID 156663942
propan-2-yl (E)-2-iodo-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 156663942) has the molecular formula C15H12F8IN3O2S and a molecular weight of 577.24 g/mol. Its IUPAC name is propan-2-yl (E)-2-iodo-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl (E)-2-iodo-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 156663942 |
| Molecular Formula | C15H12F8IN3O2S |
| Molecular Weight | 577.24 g/mol |
| Exact Mass | 576.96 |
| IUPAC Name | propan-2-yl (E)-2-iodo-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C(I)=C\n1cnc(-c2cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H12F8IN3O2S/c1-8(2)29-14(28)12(24)6-27-7-25-13(26-27)9-3-10(15(16,17)18)5-11(4-9)30(19,20,21,22)23/h3-8H,1-2H3/b12-6+ |
| InChIKey | TXYAZQCAPTTZPW-WUXMJOGZSA-N |
| XLogP | 6.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.24 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|