C16H15F8N5O2S — CID 156663947
2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide (PubChem CID 156663947) has the molecular formula C16H15F8N5O2S and a molecular weight of 493.38 g/mol. Its IUPAC name is 2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide.
| Compound Name | 2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 156663947 |
| Molecular Formula | C16H15F8N5O2S |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 2-methyl-N-[3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
| SMILES | CC(C)C(=O)N(N)C(=O)C=Cn1cnc(-c2cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H15F8N5O2S/c1-9(2)15(31)29(25)13(30)3-4-28-8-26-14(27-28)10-5-11(16(17,18)19)7-12(6-10)32(20,21,22,23)24/h3-9H,25H2,1-2H3 |
| InChIKey | UIMWNUUZFQGKEG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|