C12H7F4N3O2 — CID 71247846
3-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid (PubChem CID 71247846) has the molecular formula C12H7F4N3O2 and a molecular weight of 301.20 g/mol. Its IUPAC name is 3-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid.
| Compound Name | 3-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71247846 |
| Molecular Formula | C12H7F4N3O2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cn1cnc(-c2cc(F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H7F4N3O2/c13-9-4-7(3-8(5-9)12(14,15)16)11-17-6-19(18-11)2-1-10(20)21/h1-6H,(H,20,21) |
| InChIKey | MFKYHEPSRHWNDT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|