C21H18ClF3N4O2 — CID 66997022
propan-2-yl 3-[3-[3-(4-chloroanilino)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 66997022) has the molecular formula C21H18ClF3N4O2 and a molecular weight of 450.85 g/mol. Its IUPAC name is propan-2-yl 3-[3-[3-(4-chloroanilino)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl 3-[3-[3-(4-chloroanilino)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66997022 |
| Molecular Formula | C21H18ClF3N4O2 |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | propan-2-yl 3-[3-[3-(4-chloroanilino)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)C=Cn1cnc(-c2cc(Nc3ccc(Cl)cc3)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H18ClF3N4O2/c1-13(2)31-19(30)7-8-29-12-26-20(28-29)14-9-15(21(23,24)25)11-18(10-14)27-17-5-3-16(22)4-6-17/h3-13,27H,1-2H3 |
| InChIKey | RITUOCUQYYOITC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|