C14H9F6NO — CID 158887487
N-[3,5-bis(trifluoromethyl)phenoxy]aniline (PubChem CID 158887487) has the molecular formula C14H9F6NO and a molecular weight of 321.22 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenoxy]aniline.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenoxy]aniline |
|---|---|
| PubChem CID | 158887487 |
| Molecular Formula | C14H9F6NO |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenoxy]aniline |
| SMILES | FC(F)(F)c1cc(ONc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F6NO/c15-13(16,17)9-6-10(14(18,19)20)8-12(7-9)22-21-11-4-2-1-3-5-11/h1-8,21H |
| InChIKey | JDUVXLNMLDJFDR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|