C15H18F2N3O4S+ — CID 158344234
3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide (PubChem CID 158344234) has the molecular formula C15H18F2N3O4S+ and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide.
| Compound Name | 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide |
|---|---|
| PubChem CID | 158344234 |
| Molecular Formula | C15H18F2N3O4S+ |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-5-methyl-1H-pyridazin-2-ium 2-oxide |
| SMILES | CCS(=O)(=O)c1cccnc1-c1[nH][n+](=O)c(OCC(C)(F)F)cc1C |
| InChI | InChI=1S/C15H18F2N3O4S/c1-4-25(22,23)11-6-5-7-18-14(11)13-10(2)8-12(20(21)19-13)24-9-15(3,16)17/h5-8H,4,9H2,1-3H3,(H,19,21)/q+1 |
| InChIKey | GRNNJOFSQAGHNB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|