C15H11Cl2F5N2O3S — CID 137395456
2-chloro-6-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyridine (PubChem CID 137395456) has the molecular formula C15H11Cl2F5N2O3S and a molecular weight of 465.23 g/mol. Its IUPAC name is 2-chloro-6-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyridine.
| Compound Name | 2-chloro-6-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyridine |
|---|---|
| PubChem CID | 137395456 |
| Molecular Formula | C15H11Cl2F5N2O3S |
| Molecular Weight | 465.23 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 2-chloro-6-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyridine |
| SMILES | CCS(=O)(=O)c1ccc(Cl)nc1-c1ccc(OCC(F)(F)C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C15H11Cl2F5N2O3S/c1-2-28(25,26)10-5-6-11(16)24-12(10)8-3-4-9(13(17)23-8)27-7-14(18,19)15(20,21)22/h3-6H,2,7H2,1H3 |
| InChIKey | OGFBIIXBBSIYON-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|