C17H16F5N5O2S — CID 155102337
5-ethylsulfonyl-N-methyl-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]pyridin-2-amine (PubChem CID 155102337) has the molecular formula C17H16F5N5O2S and a molecular weight of 449.41 g/mol. Its IUPAC name is 5-ethylsulfonyl-N-methyl-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]pyridin-2-amine.
| Compound Name | 5-ethylsulfonyl-N-methyl-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 155102337 |
| Molecular Formula | C17H16F5N5O2S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 5-ethylsulfonyl-N-methyl-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]pyridin-2-amine |
| SMILES | CCS(=O)(=O)c1ccc(NC)nc1-c1cc2cnn(CC(F)(F)C(F)(F)F)c2cn1 |
| InChI | InChI=1S/C17H16F5N5O2S/c1-3-30(28,29)13-4-5-14(23-2)26-15(13)11-6-10-7-25-27(12(10)8-24-11)9-16(18,19)17(20,21)22/h4-8H,3,9H2,1-2H3,(H,23,26) |
| InChIKey | AXWQMBABCAACCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|