C20H18F5N3O2S — CID 155102344
5-(5-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine (PubChem CID 155102344) has the molecular formula C20H18F5N3O2S and a molecular weight of 459.44 g/mol. Its IUPAC name is 5-(5-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine.
| Compound Name | 5-(5-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 155102344 |
| Molecular Formula | C20H18F5N3O2S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 5-(5-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine |
| SMILES | CCS(=O)(=O)c1cc(C2CC2)cnc1-c1cc2ccn(CC(F)(F)C(F)(F)F)c2cn1 |
| InChI | InChI=1S/C20H18F5N3O2S/c1-2-31(29,30)17-8-14(12-3-4-12)9-27-18(17)15-7-13-5-6-28(16(13)10-26-15)11-19(21,22)20(23,24)25/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | YBQOTRHHPRVGLN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|