C17H18F5N3O2S — CID 161370943
5-cyclopropyl-3-ethylsulfonyl-2-[5-methyl-1-(2,2,3,3,3-pentafluoropropyl)imidazol-4-yl]pyridine (PubChem CID 161370943) has the molecular formula C17H18F5N3O2S and a molecular weight of 423.41 g/mol. Its IUPAC name is 5-cyclopropyl-3-ethylsulfonyl-2-[5-methyl-1-(2,2,3,3,3-pentafluoropropyl)imidazol-4-yl]pyridine.
| Compound Name | 5-cyclopropyl-3-ethylsulfonyl-2-[5-methyl-1-(2,2,3,3,3-pentafluoropropyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 161370943 |
| Molecular Formula | C17H18F5N3O2S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 5-cyclopropyl-3-ethylsulfonyl-2-[5-methyl-1-(2,2,3,3,3-pentafluoropropyl)imidazol-4-yl]pyridine |
| SMILES | CCS(=O)(=O)c1cc(C2CC2)cnc1-c1ncn(CC(F)(F)C(F)(F)F)c1C |
| InChI | InChI=1S/C17H18F5N3O2S/c1-3-28(26,27)13-6-12(11-4-5-11)7-23-15(13)14-10(2)25(9-24-14)8-16(18,19)17(20,21)22/h6-7,9,11H,3-5,8H2,1-2H3 |
| InChIKey | VQLHREDFSKNQBQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|