C22H24F7N5S — CID 162753258
ethane;ethyl 2-amino-4-(1,1-difluoroethyl)-N-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]benzenecarboximidothioate (PubChem CID 162753258) has the molecular formula C22H24F7N5S and a molecular weight of 523.52 g/mol. Its IUPAC name is ethane;ethyl 2-amino-4-(1,1-difluoroethyl)-N-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]benzenecarboximidothioate.
| Compound Name | ethane;ethyl 2-amino-4-(1,1-difluoroethyl)-N-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]benzenecarboximidothioate |
|---|---|
| PubChem CID | 162753258 |
| Molecular Formula | C22H24F7N5S |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | ethane;ethyl 2-amino-4-(1,1-difluoroethyl)-N-[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]benzenecarboximidothioate |
| SMILES | CC.CCS/C(=N\c1cc2cnn(CC(F)(F)C(F)(F)F)c2cn1)c1ccc(C(C)(F)F)cc1N |
| InChI | InChI=1S/C20H18F7N5S.C2H6/c1-3-33-17(13-5-4-12(7-14(13)28)18(2,21)22)31-16-6-11-8-30-32(15(11)9-29-16)10-19(23,24)20(25,26)27;1-2/h4-9H,3,10,28H2,1-2H3;1-2H3/b31-17-; |
| InChIKey | FTMLLBLJSPLYOV-FWQXUXEMSA-N |
| XLogP | 7.18 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|