C17H29F3N4S — CID 165403053
N-tert-butylsulfanyl-1-[1-(2,2,2-trifluoroethyl)pyrazolo[3,4-c]pyridin-5-yl]methanamine;ethane (PubChem CID 165403053) has the molecular formula C17H29F3N4S and a molecular weight of 378.51 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1-[1-(2,2,2-trifluoroethyl)pyrazolo[3,4-c]pyridin-5-yl]methanamine;ethane.
| Compound Name | N-tert-butylsulfanyl-1-[1-(2,2,2-trifluoroethyl)pyrazolo[3,4-c]pyridin-5-yl]methanamine;ethane |
|---|---|
| PubChem CID | 165403053 |
| Molecular Formula | C17H29F3N4S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-tert-butylsulfanyl-1-[1-(2,2,2-trifluoroethyl)pyrazolo[3,4-c]pyridin-5-yl]methanamine;ethane |
| SMILES | CC.CC.CC(C)(C)SNCc1cc2cnn(CC(F)(F)F)c2cn1 |
| InChI | InChI=1S/C13H17F3N4S.2C2H6/c1-12(2,3)21-19-6-10-4-9-5-18-20(8-13(14,15)16)11(9)7-17-10;2*1-2/h4-5,7,19H,6,8H2,1-3H3;2*1-2H3 |
| InChIKey | BWKPBBSRQUHAAT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|