C13H21F3N2 — CID 154613482
4,5-ditert-butyl-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 154613482) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-(2,2,2-trifluoroethyl)pyrazole.
| Compound Name | 4,5-ditert-butyl-1-(2,2,2-trifluoroethyl)pyrazole |
|---|---|
| PubChem CID | 154613482 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4,5-ditert-butyl-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | CC(C)(C)c1cnn(CC(F)(F)F)c1C(C)(C)C |
| InChI | InChI=1S/C13H21F3N2/c1-11(2,3)9-7-17-18(8-13(14,15)16)10(9)12(4,5)6/h7H,8H2,1-6H3 |
| InChIKey | CQFYQVDHQKXNTC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |