C7H4F6N2O — CID 139674988
1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 139674988) has the molecular formula C7H4F6N2O and a molecular weight of 246.11 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 139674988 |
| Molecular Formula | C7H4F6N2O |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cnn(CC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C7H4F6N2O/c8-6(9,10)3-15-5(7(11,12)13)4(2-16)1-14-15/h1-2H,3H2 |
| InChIKey | KPISVLXKCMAMEO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|