C13H11F3N2O — CID 82527711
1-(4-ethylphenyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 82527711) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(4-ethylphenyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82527711 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-(4-ethylphenyl)-5-(trifluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | CCc1ccc(-n2ncc(C=O)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F3N2O/c1-2-9-3-5-11(6-4-9)18-12(13(14,15)16)10(8-19)7-17-18/h3-8H,2H2,1H3 |
| InChIKey | AFVCUJBAPGVBHN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|