C17H19F3N2Si — CID 153436168
2-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethynyl-trimethylsilane (PubChem CID 153436168) has the molecular formula C17H19F3N2Si and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 153436168 |
| Molecular Formula | C17H19F3N2Si |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethynyl-trimethylsilane |
| SMILES | CCc1cnn(-c2ccc(C#C[Si](C)(C)C)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2Si/c1-5-14-12-21-22(16(14)17(18,19)20)15-8-6-13(7-9-15)10-11-23(2,3)4/h6-9,12H,5H2,1-4H3 |
| InChIKey | IDMSOYXVGQBWIL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|