C13H13F3N2S — CID 82527607
[1-(3,4-dimethylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanethiol (PubChem CID 82527607) has the molecular formula C13H13F3N2S and a molecular weight of 286.32 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanethiol.
| Compound Name | [1-(3,4-dimethylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanethiol |
|---|---|
| PubChem CID | 82527607 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [1-(3,4-dimethylphenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanethiol |
| SMILES | Cc1ccc(-n2ncc(CS)c2C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H13F3N2S/c1-8-3-4-11(5-9(8)2)18-12(13(14,15)16)10(7-19)6-17-18/h3-6,19H,7H2,1-2H3 |
| InChIKey | XHECYTVYMYLBQF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|