C14H11F3N2 — CID 153436157
4-ethyl-1-(4-ethynylphenyl)-5-(trifluoromethyl)pyrazole (PubChem CID 153436157) has the molecular formula C14H11F3N2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 4-ethyl-1-(4-ethynylphenyl)-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-ethyl-1-(4-ethynylphenyl)-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 153436157 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-ethyl-1-(4-ethynylphenyl)-5-(trifluoromethyl)pyrazole |
| SMILES | C#Cc1ccc(-n2ncc(CC)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F3N2/c1-3-10-5-7-12(8-6-10)19-13(14(15,16)17)11(4-2)9-18-19/h1,5-9H,4H2,2H3 |
| InChIKey | QEUNUFWIWJRBQI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|