C16H14Cl2F3N3O — CID 129060915
(E)-2,3-dichloro-N-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide (PubChem CID 129060915) has the molecular formula C16H14Cl2F3N3O and a molecular weight of 392.21 g/mol. Its IUPAC name is (E)-2,3-dichloro-N-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide.
| Compound Name | (E)-2,3-dichloro-N-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 129060915 |
| Molecular Formula | C16H14Cl2F3N3O |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (E)-2,3-dichloro-N-[4-[4-ethyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide |
| SMILES | CCc1cnn(-c2ccc(NC(=O)/C(Cl)=C(/C)Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C16H14Cl2F3N3O/c1-3-10-8-22-24(14(10)16(19,20)21)12-6-4-11(5-7-12)23-15(25)13(18)9(2)17/h4-8H,3H2,1-2H3,(H,23,25)/b13-9+ |
| InChIKey | JCCRJVCKJGKEAH-UKTHLTGXSA-N |
| XLogP | 5.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|