C8H10ClF3N2 — CID 176763523
5-chloro-4-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 176763523) has the molecular formula C8H10ClF3N2 and a molecular weight of 226.63 g/mol. Its IUPAC name is 5-chloro-4-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazole.
| Compound Name | 5-chloro-4-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazole |
|---|---|
| PubChem CID | 176763523 |
| Molecular Formula | C8H10ClF3N2 |
| Molecular Weight | 226.63 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-chloro-4-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | CC(C)c1cnn(CC(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H10ClF3N2/c1-5(2)6-3-13-14(7(6)9)4-8(10,11)12/h3,5H,4H2,1-2H3 |
| InChIKey | IPGAFUVIRVEZPT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |