C9H15ClN2 — CID 90145823
5-chloro-1,4-di(propan-2-yl)pyrazole (PubChem CID 90145823) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 5-chloro-1,4-di(propan-2-yl)pyrazole.
| Compound Name | 5-chloro-1,4-di(propan-2-yl)pyrazole |
|---|---|
| PubChem CID | 90145823 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-chloro-1,4-di(propan-2-yl)pyrazole |
| SMILES | CC(C)c1cnn(C(C)C)c1Cl |
| InChI | InChI=1S/C9H15ClN2/c1-6(2)8-5-11-12(7(3)4)9(8)10/h5-7H,1-4H3 |
| InChIKey | GZXRVBBXGTUWTD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |