C12H16F2N2 — CID 144678019
5-(1,1-difluoroethyl)-N'-ethyl-2-methylbenzenecarboximidamide (PubChem CID 144678019) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-N'-ethyl-2-methylbenzenecarboximidamide.
| Compound Name | 5-(1,1-difluoroethyl)-N'-ethyl-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144678019 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-(1,1-difluoroethyl)-N'-ethyl-2-methylbenzenecarboximidamide |
| SMILES | CC/N=C(\N)c1cc(C(C)(F)F)ccc1C |
| InChI | InChI=1S/C12H16F2N2/c1-4-16-11(15)10-7-9(12(3,13)14)6-5-8(10)2/h5-7H,4H2,1-3H3,(H2,15,16) |
| InChIKey | INPCNLMAGSOPOA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|