C17H15F5N2O — CID 144678459
5-(1,1-difluoroethyl)-2-hydroxy-N'-[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidamide (PubChem CID 144678459) has the molecular formula C17H15F5N2O and a molecular weight of 358.31 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-hydroxy-N'-[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidamide.
| Compound Name | 5-(1,1-difluoroethyl)-2-hydroxy-N'-[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 144678459 |
| Molecular Formula | C17H15F5N2O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-hydroxy-N'-[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidamide |
| SMILES | CC(F)(F)c1ccc(O)c(/C(N)=N/Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F5N2O/c1-16(18,19)12-6-7-14(25)13(8-12)15(23)24-9-10-2-4-11(5-3-10)17(20,21)22/h2-8,25H,9H2,1H3,(H2,23,24) |
| InChIKey | CCCUBRFUTHPUAD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|