C11H9F3N4O2 — CID 67436059
4-oxo-N'-[[4-(trifluoromethyl)phenyl]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 67436059) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 4-oxo-N'-[[4-(trifluoromethyl)phenyl]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-oxo-N'-[[4-(trifluoromethyl)phenyl]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 67436059 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-oxo-N'-[[4-(trifluoromethyl)phenyl]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(C(F)(F)F)cc1)c1no[nH]c1=O |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)7-3-1-6(2-4-7)5-16-9(15)8-10(19)18-20-17-8/h1-4H,5H2,(H2,15,16)(H,18,19) |
| InChIKey | YXGCNVLHMLQTEG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|