C17H17F3N4S — CID 123648541
[2-amino-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylimino]ethyl]thiourea (PubChem CID 123648541) has the molecular formula C17H17F3N4S and a molecular weight of 366.41 g/mol. Its IUPAC name is [2-amino-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylimino]ethyl]thiourea.
| Compound Name | [2-amino-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylimino]ethyl]thiourea |
|---|---|
| PubChem CID | 123648541 |
| Molecular Formula | C17H17F3N4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [2-amino-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylimino]ethyl]thiourea |
| SMILES | NC(=S)NC/C(N)=N/Cc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H17F3N4S/c18-17(19,20)14-7-5-13(6-8-14)12-3-1-11(2-4-12)9-23-15(21)10-24-16(22)25/h1-8H,9-10H2,(H2,21,23)(H3,22,24,25) |
| InChIKey | WFXAGLPQCRKGJT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|