C11H13F3N2 — CID 154723292
N'-propyl-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 154723292) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is N'-propyl-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-propyl-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 154723292 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | N'-propyl-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | CCC/N=C(\N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2/c1-2-7-16-10(15)8-3-5-9(6-4-8)11(12,13)14/h3-6H,2,7H2,1H3,(H2,15,16) |
| InChIKey | VCFJEXLKIYMUOQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|