C17H19F3N4O2 — CID 154715801
N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N'-propyl-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 154715801) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N'-propyl-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N'-propyl-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 154715801 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N'-propyl-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | CCC/N=C(/Nc1cc(=O)n(C)c(=O)n1C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N4O2/c1-4-9-21-15(11-5-7-12(8-6-11)17(18,19)20)22-13-10-14(25)24(3)16(26)23(13)2/h5-8,10H,4,9H2,1-3H3,(H,21,22) |
| InChIKey | WNWLVTRRDGUKNX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|