C22H21F6NOS — CID 123339655
3-(2-propylsulfanylethylimino)-1,3-bis[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 123339655) has the molecular formula C22H21F6NOS and a molecular weight of 461.47 g/mol. Its IUPAC name is 3-(2-propylsulfanylethylimino)-1,3-bis[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 3-(2-propylsulfanylethylimino)-1,3-bis[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 123339655 |
| Molecular Formula | C22H21F6NOS |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3-(2-propylsulfanylethylimino)-1,3-bis[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CCCSCC/N=C(\CC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F6NOS/c1-2-12-31-13-11-29-19(15-3-7-17(8-4-15)21(23,24)25)14-20(30)16-5-9-18(10-6-16)22(26,27)28/h3-10H,2,11-14H2,1H3/b29-19+ |
| InChIKey | DHIBFNAKNVXVDA-VUTHCHCSSA-N |
| XLogP | 6.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|