C22H23F3N4O3 — CID 50792140
N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide (PubChem CID 50792140) has the molecular formula C22H23F3N4O3 and a molecular weight of 448.45 g/mol. Its IUPAC name is N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 50792140 |
| Molecular Formula | C22H23F3N4O3 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN(CC)c1cc2c(cc1NC(=O)c1ccc(C(F)(F)F)cc1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C22H23F3N4O3/c1-5-29(6-2)16-12-18-17(27(3)20(31)21(32)28(18)4)11-15(16)26-19(30)13-7-9-14(10-8-13)22(23,24)25/h7-12H,5-6H2,1-4H3,(H,26,30) |
| InChIKey | KLNFPCIZBBJGBZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|