C23H28N4O3 — CID 17252033
4-tert-butyl-N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide (PubChem CID 17252033) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide |
|---|---|
| PubChem CID | 17252033 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-tert-butyl-N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide |
| SMILES | CN(C)c1cc2c(cc1NC(=O)c1ccc(C(C)(C)C)cc1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C23H28N4O3/c1-23(2,3)15-10-8-14(9-11-15)20(28)24-16-12-18-19(13-17(16)25(4)5)27(7)22(30)21(29)26(18)6/h8-13H,1-7H3,(H,24,28) |
| InChIKey | UWXYISRUMUORMA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|