C27H27N3O4 — CID 50793171
4-tert-butyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)benzamide (PubChem CID 50793171) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)benzamide |
|---|---|
| PubChem CID | 50793171 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-tert-butyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)benzamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(Oc3ccccc3)c(NC(=O)c3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C27H27N3O4/c1-27(2,3)18-13-11-17(12-14-18)24(31)28-20-15-21-22(30(5)26(33)25(32)29(21)4)16-23(20)34-19-9-7-6-8-10-19/h6-16H,1-5H3,(H,28,31) |
| InChIKey | MHWADKHKMXIPEZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|