C24H27N3O4 — CID 50793159
3-cyclopentyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)propanamide (PubChem CID 50793159) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-cyclopentyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)propanamide.
| Compound Name | 3-cyclopentyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)propanamide |
|---|---|
| PubChem CID | 50793159 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 3-cyclopentyl-N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)propanamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(Oc3ccccc3)c(NC(=O)CCC3CCCC3)cc21 |
| InChI | InChI=1S/C24H27N3O4/c1-26-19-14-18(25-22(28)13-12-16-8-6-7-9-16)21(31-17-10-4-3-5-11-17)15-20(19)27(2)24(30)23(26)29/h3-5,10-11,14-16H,6-9,12-13H2,1-2H3,(H,25,28) |
| InChIKey | MVSHJUXSJQPOIP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|