C24H21N3O4 — CID 50793143
N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-3-methylbenzamide (PubChem CID 50793143) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-3-methylbenzamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 50793143 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc3c(cc2Oc2ccccc2)n(C)c(=O)c(=O)n3C)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-15-8-7-9-16(12-15)22(28)25-18-13-19-20(27(3)24(30)23(29)26(19)2)14-21(18)31-17-10-5-4-6-11-17/h4-14H,1-3H3,(H,25,28) |
| InChIKey | ZZNZFHXVFDBIBJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|