C23H22N4O3 — CID 50797574
1-benzyl-3-(1,3-dimethyl-2-oxo-6-phenoxybenzimidazol-5-yl)urea (PubChem CID 50797574) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-benzyl-3-(1,3-dimethyl-2-oxo-6-phenoxybenzimidazol-5-yl)urea.
| Compound Name | 1-benzyl-3-(1,3-dimethyl-2-oxo-6-phenoxybenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 50797574 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-benzyl-3-(1,3-dimethyl-2-oxo-6-phenoxybenzimidazol-5-yl)urea |
| SMILES | Cn1c(=O)n(C)c2cc(Oc3ccccc3)c(NC(=O)NCc3ccccc3)cc21 |
| InChI | InChI=1S/C23H22N4O3/c1-26-19-13-18(25-22(28)24-15-16-9-5-3-6-10-16)21(14-20(19)27(2)23(26)29)30-17-11-7-4-8-12-17/h3-14H,15H2,1-2H3,(H2,24,25,28) |
| InChIKey | QGXFVLOCCWSMLP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |