C21H25N5O3 — CID 50791903
1-benzyl-3-(1,3-dimethyl-6-morpholin-4-yl-2-oxobenzimidazol-5-yl)urea (PubChem CID 50791903) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-benzyl-3-(1,3-dimethyl-6-morpholin-4-yl-2-oxobenzimidazol-5-yl)urea.
| Compound Name | 1-benzyl-3-(1,3-dimethyl-6-morpholin-4-yl-2-oxobenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 50791903 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-benzyl-3-(1,3-dimethyl-6-morpholin-4-yl-2-oxobenzimidazol-5-yl)urea |
| SMILES | Cn1c(=O)n(C)c2cc(N3CCOCC3)c(NC(=O)NCc3ccccc3)cc21 |
| InChI | InChI=1S/C21H25N5O3/c1-24-18-12-16(23-20(27)22-14-15-6-4-3-5-7-15)17(26-8-10-29-11-9-26)13-19(18)25(2)21(24)28/h3-7,12-13H,8-11,14H2,1-2H3,(H2,22,23,27) |
| InChIKey | XVPUEUJZBZMZBF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |