About 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea
1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea (PubChem CID 72913286) has the molecular formula C16H23N5O2S
and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea.
Molecular Properties
| Compound Name | 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea |
| PubChem CID | 72913286 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea |
| SMILES | CN(C)c1cc2c(cc1NC(=O)NC1CCSC1)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H23N5O2S/c1-19(2)12-8-14-13(20(3)16(23)21(14)4)7-11(12)18-15(22)17-10-5-6-24-9-10/h7-8,10H,5-6,9H2,1-4H3,(H2,17,18,22) |
| InChIKey | RYJQBOBRWNCVCM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea?
The IUPAC name of 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea (CID 72913286) is 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea.
What is the SMILES notation for 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea?
The canonical SMILES for 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea is CN(C)c1cc2c(cc1NC(=O)NC1CCSC1)n(C)c(=O)n2C.
What is the InChIKey of 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea?
The InChIKey is RYJQBOBRWNCVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O2S/c1-19(2)12-8-14-13(20(3)16(23)21(14)4)7-11(12)18-15(22)17-10-5-6-24-9-10/h7-8,10H,5-6,9H2,1-4H3,(H2,17,18,22).
What are the key properties of 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea?
1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea has a molecular weight of 349.46 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]-3-(thiolan-3-yl)urea is sourced from PubChem (CID 72913286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).