C21H23ClN4O3 — CID 50792040
2-chloro-N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide (PubChem CID 50792040) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-chloro-N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide.
| Compound Name | 2-chloro-N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide |
|---|---|
| PubChem CID | 50792040 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-chloro-N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide |
| SMILES | CCN(CC)c1cc2c(cc1NC(=O)c1ccccc1Cl)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C21H23ClN4O3/c1-5-26(6-2)16-12-18-17(24(3)20(28)21(29)25(18)4)11-15(16)23-19(27)13-9-7-8-10-14(13)22/h7-12H,5-6H2,1-4H3,(H,23,27) |
| InChIKey | JZHCLBPCWGJSLZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|