C20H20ClN3O3 — CID 50793038
2-chloro-N-(1,4-diethyl-7-methyl-2,3-dioxoquinoxalin-6-yl)benzamide (PubChem CID 50793038) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-chloro-N-(1,4-diethyl-7-methyl-2,3-dioxoquinoxalin-6-yl)benzamide.
| Compound Name | 2-chloro-N-(1,4-diethyl-7-methyl-2,3-dioxoquinoxalin-6-yl)benzamide |
|---|---|
| PubChem CID | 50793038 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-chloro-N-(1,4-diethyl-7-methyl-2,3-dioxoquinoxalin-6-yl)benzamide |
| SMILES | CCn1c(=O)c(=O)n(CC)c2cc(NC(=O)c3ccccc3Cl)c(C)cc21 |
| InChI | InChI=1S/C20H20ClN3O3/c1-4-23-16-10-12(3)15(11-17(16)24(5-2)20(27)19(23)26)22-18(25)13-8-6-7-9-14(13)21/h6-11H,4-5H2,1-3H3,(H,22,25) |
| InChIKey | ZGYCKQWJJXNRGK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|