C18H16ClN3O3 — CID 46249057
N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-methylbenzamide (PubChem CID 46249057) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-methylbenzamide.
| Compound Name | N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 46249057 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cc2c(cc1Cl)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C18H16ClN3O3/c1-10-6-4-5-7-11(10)16(23)20-13-9-15-14(8-12(13)19)21(2)17(24)18(25)22(15)3/h4-9H,1-3H3,(H,20,23) |
| InChIKey | QSOFRXRKZZPCKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|