C22H26N4O4 — CID 50792211
N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-methoxybenzamide (PubChem CID 50792211) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-methoxybenzamide.
| Compound Name | N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 50792211 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-methoxybenzamide |
| SMILES | CCN(CC)c1cc2c(cc1NC(=O)c1ccccc1OC)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C22H26N4O4/c1-6-26(7-2)16-13-18-17(24(3)21(28)22(29)25(18)4)12-15(16)23-20(27)14-10-8-9-11-19(14)30-5/h8-13H,6-7H2,1-5H3,(H,23,27) |
| InChIKey | ATFDQVXQRDPKSI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|