C17H18N4O3S — CID 17252021
N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]thiophene-2-carboxamide (PubChem CID 17252021) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]thiophene-2-carboxamide.
| Compound Name | N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17252021 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]thiophene-2-carboxamide |
| SMILES | CN(C)c1cc2c(cc1NC(=O)c1cccs1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C17H18N4O3S/c1-19(2)11-9-13-12(20(3)16(23)17(24)21(13)4)8-10(11)18-15(22)14-6-5-7-25-14/h5-9H,1-4H3,(H,18,22) |
| InChIKey | BJJDOFQEANWKFE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|