C18H11N3O4S2 — CID 3600207
N-(1,3-dioxoisoindol-2-yl)-3-(thiophene-2-carbonylamino)thiophene-2-carboxamide (PubChem CID 3600207) has the molecular formula C18H11N3O4S2 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-2-yl)-3-(thiophene-2-carbonylamino)thiophene-2-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-2-yl)-3-(thiophene-2-carbonylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3600207 |
| Molecular Formula | C18H11N3O4S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-(1,3-dioxoisoindol-2-yl)-3-(thiophene-2-carbonylamino)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccsc1C(=O)NN1C(=O)c2ccccc2C1=O)c1cccs1 |
| InChI | InChI=1S/C18H11N3O4S2/c22-15(13-6-3-8-26-13)19-12-7-9-27-14(12)16(23)20-21-17(24)10-4-1-2-5-11(10)18(21)25/h1-9H,(H,19,22)(H,20,23) |
| InChIKey | IYAODIHIZYSNMR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|